C14H18N2O2S — CID 51359876
2-benzyl-4-(2,5-dihydropyrrol-1-yl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 51359876) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-benzyl-4-(2,5-dihydropyrrol-1-yl)-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-benzyl-4-(2,5-dihydropyrrol-1-yl)-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 51359876 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-benzyl-4-(2,5-dihydropyrrol-1-yl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CC(N2CC=CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H18N2O2S/c17-19(18)12-14(15-8-4-5-9-15)11-16(19)10-13-6-2-1-3-7-13/h1-7,14H,8-12H2 |
| InChIKey | NTKPCMVUBKPMQJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|