C15H20N2O2S — CID 51359906
4-(2,5-dihydropyrrol-1-yl)-2-[(4-methylphenyl)methyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 51359906) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-yl)-2-[(4-methylphenyl)methyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 4-(2,5-dihydropyrrol-1-yl)-2-[(4-methylphenyl)methyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 51359906 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-yl)-2-[(4-methylphenyl)methyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | Cc1ccc(CN2CC(N3CC=CC3)CS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H20N2O2S/c1-13-4-6-14(7-5-13)10-17-11-15(12-20(17,18)19)16-8-2-3-9-16/h2-7,15H,8-12H2,1H3 |
| InChIKey | LSYVXBYXLRNBAD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|