About 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide
2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 51359912) has the molecular formula C19H37N3O2S
and a molecular weight of 371.59 g/mol. Its IUPAC name is 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 51359912 |
| Molecular Formula | C19H37N3O2S |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | CCCCCCN1CCN(C2CN(C3CCCCC3)S(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C19H37N3O2S/c1-2-3-4-8-11-20-12-14-21(15-13-20)19-16-22(25(23,24)17-19)18-9-6-5-7-10-18/h18-19H,2-17H2,1H3 |
| InChIKey | FMJYOBZXQSQQOH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide (CID 51359912) is 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide is CCCCCCN1CCN(C2CN(C3CCCCC3)S(=O)(=O)C2)CC1.
What is the InChIKey of 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide?
The InChIKey is FMJYOBZXQSQQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N3O2S/c1-2-3-4-8-11-20-12-14-21(15-13-20)19-16-22(25(23,24)17-19)18-9-6-5-7-10-18/h18-19H,2-17H2,1H3.
What are the key properties of 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide?
2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide has a molecular weight of 371.59 g/mol, XLogP of 2.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-(4-hexylpiperazin-1-yl)-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 51359912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).