About 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine
2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine (PubChem CID 51359995) has the molecular formula C22H16ClF3N2
and a molecular weight of 400.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine |
| PubChem CID | 51359995 |
| Molecular Formula | C22H16ClF3N2 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1ccc2nc(-c3cccc(Cl)c3)c(Cc3ccccc3C(F)(F)F)n2c1 |
| InChI | InChI=1S/C22H16ClF3N2/c1-14-9-10-20-27-21(16-6-4-7-17(23)11-16)19(28(20)13-14)12-15-5-2-3-8-18(15)22(24,25)26/h2-11,13H,12H2,1H3 |
| InChIKey | OGAWTJYBHAKIIP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine?
The IUPAC name of 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine (CID 51359995) is 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine is Cc1ccc2nc(-c3cccc(Cl)c3)c(Cc3ccccc3C(F)(F)F)n2c1.
What is the InChIKey of 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine?
The InChIKey is OGAWTJYBHAKIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClF3N2/c1-14-9-10-20-27-21(16-6-4-7-17(23)11-16)19(28(20)13-14)12-15-5-2-3-8-18(15)22(24,25)26/h2-11,13H,12H2,1H3.
What are the key properties of 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine?
2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine has a molecular weight of 400.83 g/mol, XLogP of 6.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-6-methyl-3-[[2-(trifluoromethyl)phenyl]methyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 51359995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).