About 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine
2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine (PubChem CID 51360020) has the molecular formula C21H20N2O2S
and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine |
| PubChem CID | 51360020 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2nc3ccc(C)cn3c2Cc2ccsc2)cc1OC |
| InChI | InChI=1S/C21H20N2O2S/c1-14-4-7-20-22-21(16-5-6-18(24-2)19(11-16)25-3)17(23(20)12-14)10-15-8-9-26-13-15/h4-9,11-13H,10H2,1-3H3 |
| InChIKey | LBUQPMLSUHGEOU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine (CID 51360020) is 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine is COc1ccc(-c2nc3ccc(C)cn3c2Cc2ccsc2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine?
The InChIKey is LBUQPMLSUHGEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O2S/c1-14-4-7-20-22-21(16-5-6-18(24-2)19(11-16)25-3)17(23(20)12-14)10-15-8-9-26-13-15/h4-9,11-13H,10H2,1-3H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine?
2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine has a molecular weight of 364.47 g/mol, XLogP of 4.98, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-6-methyl-3-(thiophen-3-ylmethyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 51360020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).