C18H18F4O4 — CID 51360089
(5S,7R)-5-(4-fluorophenyl)-2,2-dimethyl-7-(3,3,3-trifluoropropyl)-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one (PubChem CID 51360089) has the molecular formula C18H18F4O4 and a molecular weight of 374.33 g/mol. Its IUPAC name is (5S,7R)-5-(4-fluorophenyl)-2,2-dimethyl-7-(3,3,3-trifluoropropyl)-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one.
| Compound Name | (5S,7R)-5-(4-fluorophenyl)-2,2-dimethyl-7-(3,3,3-trifluoropropyl)-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 51360089 |
| Molecular Formula | C18H18F4O4 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (5S,7R)-5-(4-fluorophenyl)-2,2-dimethyl-7-(3,3,3-trifluoropropyl)-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one |
| SMILES | CC1(C)OC(=O)C2=C(C[C@@H](CCC(F)(F)F)O[C@H]2c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C18H18F4O4/c1-17(2)25-13-9-12(7-8-18(20,21)22)24-15(14(13)16(23)26-17)10-3-5-11(19)6-4-10/h3-6,12,15H,7-9H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | WHXKSMKFBRIDLY-DOMZBBRYSA-N |
| XLogP | 4.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |