C24H31ClO4 — CID 51360094
(5S,7R)-5-(4-chlorophenyl)-7-[(2S)-2,6-dimethylhept-5-enyl]-2,2-dimethyl-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one (PubChem CID 51360094) has the molecular formula C24H31ClO4 and a molecular weight of 418.96 g/mol. Its IUPAC name is (5S,7R)-5-(4-chlorophenyl)-7-[(2S)-2,6-dimethylhept-5-enyl]-2,2-dimethyl-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one.
| Compound Name | (5S,7R)-5-(4-chlorophenyl)-7-[(2S)-2,6-dimethylhept-5-enyl]-2,2-dimethyl-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 51360094 |
| Molecular Formula | C24H31ClO4 |
| Molecular Weight | 418.96 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (5S,7R)-5-(4-chlorophenyl)-7-[(2S)-2,6-dimethylhept-5-enyl]-2,2-dimethyl-7,8-dihydro-5H-pyrano[4,3-d][1,3]dioxin-4-one |
| SMILES | CC(C)=CCC[C@H](C)C[C@@H]1CC2=C(C(=O)OC(C)(C)O2)[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C24H31ClO4/c1-15(2)7-6-8-16(3)13-19-14-20-21(23(26)29-24(4,5)28-20)22(27-19)17-9-11-18(25)12-10-17/h7,9-12,16,19,22H,6,8,13-14H2,1-5H3/t16-,19+,22-/m0/s1 |
| InChIKey | BVMQMOAFGZVHJN-NBCNXNJRSA-N |
| XLogP | 6.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.96 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|