C22H27FN2O2S — CID 51360106
7-[(2S)-2,6-dimethylhept-5-enyl]-5-(4-fluorophenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 51360106) has the molecular formula C22H27FN2O2S and a molecular weight of 402.54 g/mol. Its IUPAC name is 7-[(2S)-2,6-dimethylhept-5-enyl]-5-(4-fluorophenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 7-[(2S)-2,6-dimethylhept-5-enyl]-5-(4-fluorophenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51360106 |
| Molecular Formula | C22H27FN2O2S |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 7-[(2S)-2,6-dimethylhept-5-enyl]-5-(4-fluorophenyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | CC(C)=CCC[C@H](C)CC1Cc2[nH]c(=S)[nH]c(=O)c2C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C22H27FN2O2S/c1-13(2)5-4-6-14(3)11-17-12-18-19(21(26)25-22(28)24-18)20(27-17)15-7-9-16(23)10-8-15/h5,7-10,14,17,20H,4,6,11-12H2,1-3H3,(H2,24,25,26,28)/t14-,17?,20?/m0/s1 |
| InChIKey | BRAXKJFXROHXHC-JTOQLSFASA-N |
| XLogP | 5.37 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|