C16H17N3O6S — CID 51360140
(E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 51360140) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 51360140 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)NCc1cccs1 |
| InChI | InChI=1S/C16H17N3O6S/c20-11(17-8-9-2-1-7-26-9)4-3-10-13(22)14(23)15(25-10)19-6-5-12(21)18-16(19)24/h1-7,10,13-15,22-23H,8H2,(H,17,20)(H,18,21,24)/b4-3+/t10-,13-,14-,15-/m1/s1 |
| InChIKey | NSWKFSBHMGLFCP-OHIVHSEUSA-N |
| XLogP | -0.91 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|