C17H18N4O6 — CID 51360142
(E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 51360142) has the molecular formula C17H18N4O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 51360142 |
| Molecular Formula | C17H18N4O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (E)-3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)NCc1cccnc1 |
| InChI | InChI=1S/C17H18N4O6/c22-12(19-9-10-2-1-6-18-8-10)4-3-11-14(24)15(25)16(27-11)21-7-5-13(23)20-17(21)26/h1-8,11,14-16,24-25H,9H2,(H,19,22)(H,20,23,26)/b4-3+/t11-,14-,15-,16-/m1/s1 |
| InChIKey | ICNZMBTXBKYYRJ-FAGVEOQPSA-N |
| XLogP | -1.58 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|