C19H21N5O5 — CID 51360304
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(1-pyridin-4-ylpyrrol-2-yl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 51360304) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(1-pyridin-4-ylpyrrol-2-yl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(1-pyridin-4-ylpyrrol-2-yl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51360304 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(1-pyridin-4-ylpyrrol-2-yl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H](CNCc3cccn3-c3ccncc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C19H21N5O5/c25-15-5-9-24(19(28)22-15)18-17(27)16(26)14(29-18)11-21-10-13-2-1-8-23(13)12-3-6-20-7-4-12/h1-9,14,16-18,21,26-27H,10-11H2,(H,22,25,28)/t14-,16-,17-,18-/m1/s1 |
| InChIKey | BGLQOVBSUKKJJE-VDHUWJSZSA-N |
| XLogP | -0.87 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |