C20H20BrN3O4 — CID 5136031
N-(2-bromophenyl)-N'-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]propanediamide (PubChem CID 5136031) has the molecular formula C20H20BrN3O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 5136031 |
| Molecular Formula | C20H20BrN3O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-(2-bromophenyl)-N'-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylideneamino]propanediamide |
| SMILES | C=CCc1cc(C=NNC(=O)CC(=O)Nc2ccccc2Br)cc(OC)c1O |
| InChI | InChI=1S/C20H20BrN3O4/c1-3-6-14-9-13(10-17(28-2)20(14)27)12-22-24-19(26)11-18(25)23-16-8-5-4-7-15(16)21/h3-5,7-10,12,27H,1,6,11H2,2H3,(H,23,25)(H,24,26) |
| InChIKey | USTXHCVZGRXLMQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|