C24H29N7O — CID 51360397
3-[1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 51360397) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-[1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 51360397 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 3-[1-[(1-tert-butyltetrazol-5-yl)-phenylmethyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | CC(C)(C)n1nnnc1C(c1ccccc1)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C24H29N7O/c1-24(2,3)31-22(26-27-28-31)21(17-9-5-4-6-10-17)29-15-13-18(14-16-29)30-20-12-8-7-11-19(20)25-23(30)32/h4-12,18,21H,13-16H2,1-3H3,(H,25,32) |
| InChIKey | GAWCIIFGUYQMEF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |