About (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide
(3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide (PubChem CID 51360541) has the molecular formula C18H18BrNO3S
and a molecular weight of 408.32 g/mol. Its IUPAC name is (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide |
| PubChem CID | 51360541 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C=C[C@@H](COCc2ccccc2)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrNO3S/c19-17-8-6-15(7-9-17)12-20-18(10-11-24(20,21)22)14-23-13-16-4-2-1-3-5-16/h1-11,18H,12-14H2/t18-/m0/s1 |
| InChIKey | GSGQMERQDFFDRC-SFHVURJKSA-N |
| XLogP | 3.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide?
The IUPAC name of (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide (CID 51360541) is (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide.
What is the SMILES notation for (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide?
The canonical SMILES for (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide is O=S1(=O)C=C[C@@H](COCc2ccccc2)N1Cc1ccc(Br)cc1.
What is the InChIKey of (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide?
The InChIKey is GSGQMERQDFFDRC-SFHVURJKSA-N. The full InChI is InChI=1S/C18H18BrNO3S/c19-17-8-6-15(7-9-17)12-20-18(10-11-24(20,21)22)14-23-13-16-4-2-1-3-5-16/h1-11,18H,12-14H2/t18-/m0/s1.
What are the key properties of (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide?
(3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide has a molecular weight of 408.32 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-[(4-bromophenyl)methyl]-3-(phenylmethoxymethyl)-3H-1,2-thiazole 1,1-dioxide is sourced from PubChem (CID 51360541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).