C13H18N2O2S — CID 51360547
2-benzyl-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,2]thiazole 1,1-dioxide (PubChem CID 51360547) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-benzyl-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,2]thiazole 1,1-dioxide.
| Compound Name | 2-benzyl-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,2]thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 51360547 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-benzyl-5-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-d][1,2]thiazole 1,1-dioxide |
| SMILES | CN1CC2CN(Cc3ccccc3)S(=O)(=O)C2C1 |
| InChI | InChI=1S/C13H18N2O2S/c1-14-8-12-9-15(18(16,17)13(12)10-14)7-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| InChIKey | AZDQEZGLKNPWJS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |