C14H17FN2O2S — CID 51360650
4-(2,5-dihydropyrrol-1-yl)-2-[(4-fluorophenyl)methyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 51360650) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-yl)-2-[(4-fluorophenyl)methyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 4-(2,5-dihydropyrrol-1-yl)-2-[(4-fluorophenyl)methyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 51360650 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-yl)-2-[(4-fluorophenyl)methyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CC(N2CC=CC2)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O2S/c15-13-5-3-12(4-6-13)9-17-10-14(11-20(17,18)19)16-7-1-2-8-16/h1-6,14H,7-11H2 |
| InChIKey | IGERTZSSWQFMTH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|