About methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate
methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate (PubChem CID 51360654) has the molecular formula C17H23N3O6S
and a molecular weight of 397.45 g/mol. Its IUPAC name is methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate |
| PubChem CID | 51360654 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C2CN(Cc3ccc([N+](=O)[O-])cc3)S(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H23N3O6S/c1-26-17(21)14-6-8-18(9-7-14)16-11-19(27(24,25)12-16)10-13-2-4-15(5-3-13)20(22)23/h2-5,14,16H,6-12H2,1H3 |
| InChIKey | HYJAFNZJEVOLPF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate (CID 51360654) is methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate is COC(=O)C1CCN(C2CN(Cc3ccc([N+](=O)[O-])cc3)S(=O)(=O)C2)CC1.
What is the InChIKey of methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate?
The InChIKey is HYJAFNZJEVOLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O6S/c1-26-17(21)14-6-8-18(9-7-14)16-11-19(27(24,25)12-16)10-13-2-4-15(5-3-13)20(22)23/h2-5,14,16H,6-12H2,1H3.
What are the key properties of methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate?
methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate has a molecular weight of 397.45 g/mol, XLogP of 0.99, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-[(4-nitrophenyl)methyl]-1,1-dioxo-1,2-thiazolidin-4-yl]piperidine-4-carboxylate is sourced from PubChem (CID 51360654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).