About 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine
6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine (PubChem CID 51360726) has the molecular formula C23H21BrN2
and a molecular weight of 405.34 g/mol. Its IUPAC name is 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine |
| PubChem CID | 51360726 |
| Molecular Formula | C23H21BrN2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine |
| SMILES | Cc1ccc(Cc2c(-c3ccccc3)nc3cc(C)c(Br)c(C)n23)cc1 |
| InChI | InChI=1S/C23H21BrN2/c1-15-9-11-18(12-10-15)14-20-23(19-7-5-4-6-8-19)25-21-13-16(2)22(24)17(3)26(20)21/h4-13H,14H2,1-3H3 |
| InChIKey | JRQBSHGZVLUHDL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine?
The IUPAC name of 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine (CID 51360726) is 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine?
The canonical SMILES for 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine is Cc1ccc(Cc2c(-c3ccccc3)nc3cc(C)c(Br)c(C)n23)cc1.
What is the InChIKey of 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine?
The InChIKey is JRQBSHGZVLUHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21BrN2/c1-15-9-11-18(12-10-15)14-20-23(19-7-5-4-6-8-19)25-21-13-16(2)22(24)17(3)26(20)21/h4-13H,14H2,1-3H3.
What are the key properties of 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine?
6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine has a molecular weight of 405.34 g/mol, XLogP of 6.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5,7-dimethyl-3-[(4-methylphenyl)methyl]-2-phenylimidazo[1,2-a]pyridine is sourced from PubChem (CID 51360726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).