About 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine
5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine (PubChem CID 51360907) has the molecular formula C16H13ClN4
and a molecular weight of 296.76 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine |
| PubChem CID | 51360907 |
| Molecular Formula | C16H13ClN4 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine |
| SMILES | Clc1cccc(N2Cc3ccccc3-n3nncc3C2)c1 |
| InChI | InChI=1S/C16H13ClN4/c17-13-5-3-6-14(8-13)20-10-12-4-1-2-7-16(12)21-15(11-20)9-18-19-21/h1-9H,10-11H2 |
| InChIKey | HABGVNXZMVXDOZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine?
The IUPAC name of 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine (CID 51360907) is 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine.
What is the SMILES notation for 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine?
The canonical SMILES for 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine is Clc1cccc(N2Cc3ccccc3-n3nncc3C2)c1.
What is the InChIKey of 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine?
The InChIKey is HABGVNXZMVXDOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN4/c17-13-5-3-6-14(8-13)20-10-12-4-1-2-7-16(12)21-15(11-20)9-18-19-21/h1-9H,10-11H2.
What are the key properties of 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine?
5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine has a molecular weight of 296.76 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-4,6-dihydrotriazolo[1,5-a][1,4]benzodiazepine is sourced from PubChem (CID 51360907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).