About 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one
10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one (PubChem CID 51360958) has the molecular formula C19H14F3NO
and a molecular weight of 329.32 g/mol. Its IUPAC name is 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one.
Molecular Properties
| Compound Name | 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one |
| PubChem CID | 51360958 |
| Molecular Formula | C19H14F3NO |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one |
| SMILES | O=C1c2cccc(-c3ccc(C(F)(F)F)cc3)c2C2CC=CCN12 |
| InChI | InChI=1S/C19H14F3NO/c20-19(21,22)13-9-7-12(8-10-13)14-4-3-5-15-17(14)16-6-1-2-11-23(16)18(15)24/h1-5,7-10,16H,6,11H2 |
| InChIKey | YAVYKDPEGMPSIY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one?
The IUPAC name of 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one (CID 51360958) is 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one.
What is the SMILES notation for 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one?
The canonical SMILES for 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one is O=C1c2cccc(-c3ccc(C(F)(F)F)cc3)c2C2CC=CCN12.
What is the InChIKey of 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one?
The InChIKey is YAVYKDPEGMPSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3NO/c20-19(21,22)13-9-7-12(8-10-13)14-4-3-5-15-17(14)16-6-1-2-11-23(16)18(15)24/h1-5,7-10,16H,6,11H2.
What are the key properties of 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one?
10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one has a molecular weight of 329.32 g/mol, XLogP of 4.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[4-(trifluoromethyl)phenyl]-4,10b-dihydro-1H-pyrido[1,2-b]isoindol-6-one is sourced from PubChem (CID 51360958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).