C25H35N3O — CID 51361018
(1S,15R,16S,20S)-18-cyclohexyl-16,19-dimethyl-17-oxa-3,13,19-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene (PubChem CID 51361018) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is (1S,15R,16S,20S)-18-cyclohexyl-16,19-dimethyl-17-oxa-3,13,19-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene.
| Compound Name | (1S,15R,16S,20S)-18-cyclohexyl-16,19-dimethyl-17-oxa-3,13,19-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 51361018 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | (1S,15R,16S,20S)-18-cyclohexyl-16,19-dimethyl-17-oxa-3,13,19-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8-tetraene |
| SMILES | C[C@@H]1OC(C2CCCCC2)N(C)[C@H]2C[C@H]3c4[nH]c5ccccc5c4CCN3C[C@@H]12 |
| InChI | InChI=1S/C25H35N3O/c1-16-20-15-28-13-12-19-18-10-6-7-11-21(18)26-24(19)23(28)14-22(20)27(2)25(29-16)17-8-4-3-5-9-17/h6-7,10-11,16-17,20,22-23,25-26H,3-5,8-9,12-15H2,1-2H3/t16-,20-,22-,23-,25?/m0/s1 |
| InChIKey | AUBFQKOABZKPFV-YQWGFCSGSA-N |
| XLogP | 4.71 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|