About 2-ethyl-6,8-difluoroquinoline
2-ethyl-6,8-difluoroquinoline (PubChem CID 51361067) has the molecular formula C11H9F2N
and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-ethyl-6,8-difluoroquinoline.
Molecular Properties
| Compound Name | 2-ethyl-6,8-difluoroquinoline |
| PubChem CID | 51361067 |
| Molecular Formula | C11H9F2N |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-ethyl-6,8-difluoroquinoline |
| SMILES | CCc1ccc2cc(F)cc(F)c2n1 |
| InChI | InChI=1S/C11H9F2N/c1-2-9-4-3-7-5-8(12)6-10(13)11(7)14-9/h3-6H,2H2,1H3 |
| InChIKey | BUZLATQAKPOWKR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-6,8-difluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6,8-difluoroquinoline?
The IUPAC name of 2-ethyl-6,8-difluoroquinoline (CID 51361067) is 2-ethyl-6,8-difluoroquinoline.
What is the SMILES notation for 2-ethyl-6,8-difluoroquinoline?
The canonical SMILES for 2-ethyl-6,8-difluoroquinoline is CCc1ccc2cc(F)cc(F)c2n1.
What is the InChIKey of 2-ethyl-6,8-difluoroquinoline?
The InChIKey is BUZLATQAKPOWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2N/c1-2-9-4-3-7-5-8(12)6-10(13)11(7)14-9/h3-6H,2H2,1H3.
What are the key properties of 2-ethyl-6,8-difluoroquinoline?
2-ethyl-6,8-difluoroquinoline has a molecular weight of 193.20 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6,8-difluoroquinoline is sourced from PubChem (CID 51361067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).