C27H30N4O7 — CID 51361584
(2S)-N-benzyl-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenylpropanamide (PubChem CID 51361584) has the molecular formula C27H30N4O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 51361584 |
| Molecular Formula | C27H30N4O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (2S)-N-benzyl-2-[3-[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]propanoylamino]-3-phenylpropanamide |
| SMILES | O=C(CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)N[C@@H](Cc1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H30N4O7/c32-21(12-11-20-23(34)24(35)26(38-20)31-14-13-22(33)30-27(31)37)29-19(15-17-7-3-1-4-8-17)25(36)28-16-18-9-5-2-6-10-18/h1-10,13-14,19-20,23-24,26,34-35H,11-12,15-16H2,(H,28,36)(H,29,32)(H,30,33,37)/t19-,20+,23+,24+,26+/m0/s1 |
| InChIKey | FDTXCXJVXGFDAF-HDKZPKJVSA-N |
| XLogP | -0.02 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |