C26H33N7O6 — CID 51361591
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[3-(3-morpholin-4-ylpropylamino)-3-oxopropyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 51361591) has the molecular formula C26H33N7O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[3-(3-morpholin-4-ylpropylamino)-3-oxopropyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[3-(3-morpholin-4-ylpropylamino)-3-oxopropyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 51361591 |
| Molecular Formula | C26H33N7O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[3-(3-morpholin-4-ylpropylamino)-3-oxopropyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C26H33N7O6/c34-19(27-9-4-10-32-11-13-38-14-12-32)8-7-18-21(35)22(36)26(39-18)33-16-30-20-23(28-15-29-24(20)33)31-25(37)17-5-2-1-3-6-17/h1-3,5-6,15-16,18,21-22,26,35-36H,4,7-14H2,(H,27,34)(H,28,29,31,37)/t18-,21-,22-,26-/m1/s1 |
| InChIKey | LHYZUJSMSQENRV-IUVOSCESSA-N |
| XLogP | 0.32 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|