C33H32N6O5 — CID 51361610
N-[9-[(2R,3R,4S,5R)-5-[3-(2,2-diphenylethylamino)-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 51361610) has the molecular formula C33H32N6O5 and a molecular weight of 592.66 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-[3-(2,2-diphenylethylamino)-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-[3-(2,2-diphenylethylamino)-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 51361610 |
| Molecular Formula | C33H32N6O5 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-[3-(2,2-diphenylethylamino)-3-oxopropyl]-3,4-dihydroxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(CC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32N6O5/c40-26(34-18-24(21-10-4-1-5-11-21)22-12-6-2-7-13-22)17-16-25-28(41)29(42)33(44-25)39-20-37-27-30(35-19-36-31(27)39)38-32(43)23-14-8-3-9-15-23/h1-15,19-20,24-25,28-29,33,41-42H,16-18H2,(H,34,40)(H,35,36,38,43)/t25-,28-,29-,33-/m1/s1 |
| InChIKey | KEQPWJFIJANBDQ-ABACMYBCSA-N |
| XLogP | 3.43 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |