C30H29N7O6 — CID 51361634
N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 51361634) has the molecular formula C30H29N7O6 and a molecular weight of 583.61 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 51361634 |
| Molecular Formula | C30H29N7O6 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[(E)-3-[2-(5-methoxy-1H-indol-3-yl)ethylamino]-3-oxoprop-1-enyl]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)/C=C/[C@H]3O[C@@H](n4cnc5c(NC(=O)c6ccccc6)ncnc54)[C@H](O)[C@@H]3O)c2c1 |
| InChI | InChI=1S/C30H29N7O6/c1-42-19-7-8-21-20(13-19)18(14-32-21)11-12-31-23(38)10-9-22-25(39)26(40)30(43-22)37-16-35-24-27(33-15-34-28(24)37)36-29(41)17-5-3-2-4-6-17/h2-10,13-16,22,25-26,30,32,39-40H,11-12H2,1H3,(H,31,38)(H,33,34,36,41)/b10-9+/t22-,25-,26-,30-/m1/s1 |
| InChIKey | AHUQZJJLOMYSDU-URXKUSLTSA-N |
| XLogP | 2.10 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|