C29H28N6O7 — CID 51361635
methyl (2R)-2-[[(E)-3-[(2R,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 51361635) has the molecular formula C29H28N6O7 and a molecular weight of 572.58 g/mol. Its IUPAC name is methyl (2R)-2-[[(E)-3-[(2R,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(E)-3-[(2R,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 51361635 |
| Molecular Formula | C29H28N6O7 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | methyl (2R)-2-[[(E)-3-[(2R,3S,4R,5R)-5-(6-benzamidopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)/C=C/[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H28N6O7/c1-41-29(40)19(14-17-8-4-2-5-9-17)33-21(36)13-12-20-23(37)24(38)28(42-20)35-16-32-22-25(30-15-31-26(22)35)34-27(39)18-10-6-3-7-11-18/h2-13,15-16,19-20,23-24,28,37-38H,14H2,1H3,(H,33,36)(H,30,31,34,39)/b13-12+/t19-,20-,23-,24-,28-/m1/s1 |
| InChIKey | FIAYTFGXTCSGME-HQUMJPJTSA-N |
| XLogP | 1.15 |
| TPSA | 177.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|