C14H22N4O6S — CID 51361708
(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]oxolane-2-carboxamide (PubChem CID 51361708) has the molecular formula C14H22N4O6S and a molecular weight of 374.42 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51361708 |
| Molecular Formula | C14H22N4O6S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-N-[(2S)-1-hydroxy-4-methylsulfanylbutan-2-yl]oxolane-2-carboxamide |
| SMILES | CSCC[C@@H](CO)NC(=O)[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H22N4O6S/c1-25-5-3-7(6-19)16-12(22)11-9(20)10(21)13(24-11)18-4-2-8(15)17-14(18)23/h2,4,7,9-11,13,19-21H,3,5-6H2,1H3,(H,16,22)(H2,15,17,23)/t7-,9-,10+,11-,13+/m0/s1 |
| InChIKey | JXTNYRWLYIUUCG-YUGVXFKWSA-N |
| XLogP | -2.33 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |