C19H22N6O6 — CID 51361716
N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 51361716) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51361716 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)cc1OC |
| InChI | InChI=1S/C19H22N6O6/c1-29-10-4-3-9(5-11(10)30-2)18(28)21-6-12-14(26)15(27)19(31-12)25-8-24-13-16(20)22-7-23-17(13)25/h3-5,7-8,12,14-15,19,26-27H,6H2,1-2H3,(H,21,28)(H2,20,22,23)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | TXLDLLBMIMYGDJ-QEPJRFBGSA-N |
| XLogP | -0.53 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |