C21H24N2O3 — CID 51361867
1-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]pyridin-2-one (PubChem CID 51361867) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]pyridin-2-one.
| Compound Name | 1-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 51361867 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(E)-1-(4-ethoxyphenyl)-3-oxo-3-piperidin-1-ylprop-1-en-2-yl]pyridin-2-one |
| SMILES | CCOc1ccc(/C=C(\C(=O)N2CCCCC2)n2ccccc2=O)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-26-18-11-9-17(10-12-18)16-19(23-15-7-4-8-20(23)24)21(25)22-13-5-3-6-14-22/h4,7-12,15-16H,2-3,5-6,13-14H2,1H3/b19-16+ |
| InChIKey | IGFHBZACZXSMIU-KNTRCKAVSA-N |
| XLogP | 3.26 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|