About 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide
4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide (PubChem CID 51362146) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide |
| PubChem CID | 51362146 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide |
| SMILES | CCC(=O)NNC(=O)CCC(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H25N3O3/c1-4-12(18)15-16-13(19)5-6-14(20)17-8-10(2)7-11(3)9-17/h10-11H,4-9H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | WYXQCMNCKWYDGV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide?
The IUPAC name of 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide (CID 51362146) is 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide.
What is the SMILES notation for 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide?
The canonical SMILES for 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide is CCC(=O)NNC(=O)CCC(=O)N1CC(C)CC(C)C1.
What is the InChIKey of 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide?
The InChIKey is WYXQCMNCKWYDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3/c1-4-12(18)15-16-13(19)5-6-14(20)17-8-10(2)7-11(3)9-17/h10-11H,4-9H2,1-3H3,(H,15,18)(H,16,19).
What are the key properties of 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide?
4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide has a molecular weight of 283.37 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpiperidin-1-yl)-4-oxo-N'-propanoylbutanehydrazide is sourced from PubChem (CID 51362146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).