C17H19N3O2 — CID 51362474
N-(2-phenylethyl)-N'-pyridin-3-ylbutanediamide (PubChem CID 51362474) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(2-phenylethyl)-N'-pyridin-3-ylbutanediamide.
| Compound Name | N-(2-phenylethyl)-N'-pyridin-3-ylbutanediamide |
|---|---|
| PubChem CID | 51362474 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(2-phenylethyl)-N'-pyridin-3-ylbutanediamide |
| SMILES | O=C(CCC(=O)Nc1cccnc1)NCCc1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c21-16(19-12-10-14-5-2-1-3-6-14)8-9-17(22)20-15-7-4-11-18-13-15/h1-7,11,13H,8-10,12H2,(H,19,21)(H,20,22) |
| InChIKey | FXXSNRFNRPMAPK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |