C12H20N2O3 — CID 51362590
N'-(oxolan-2-ylmethyl)-N-prop-2-enylbutanediamide (PubChem CID 51362590) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N'-(oxolan-2-ylmethyl)-N-prop-2-enylbutanediamide.
| Compound Name | N'-(oxolan-2-ylmethyl)-N-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 51362590 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N'-(oxolan-2-ylmethyl)-N-prop-2-enylbutanediamide |
| SMILES | C=CCNC(=O)CCC(=O)NCC1CCCO1 |
| InChI | InChI=1S/C12H20N2O3/c1-2-7-13-11(15)5-6-12(16)14-9-10-4-3-8-17-10/h2,10H,1,3-9H2,(H,13,15)(H,14,16) |
| InChIKey | LYLOXPLWBJJNGR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|