C16H17ClN6O — CID 51362877
5-(chloromethyl)-2-(4-phenylpiperazin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 51362877) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(4-phenylpiperazin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(chloromethyl)-2-(4-phenylpiperazin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 51362877 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-(chloromethyl)-2-(4-phenylpiperazin-1-yl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc(CCl)nc2nc(N3CCN(c4ccccc4)CC3)[nH]n12 |
| InChI | InChI=1S/C16H17ClN6O/c17-11-12-10-14(24)23-15(18-12)19-16(20-23)22-8-6-21(7-9-22)13-4-2-1-3-5-13/h1-5,10H,6-9,11H2,(H,18,19,20) |
| InChIKey | UZZNJZBPDGZEGC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|