C22H27N5O2S — CID 51363527
2-[2-(3-methylpiperidin-1-yl)-7-oxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 51363527) has the molecular formula C22H27N5O2S and a molecular weight of 425.56 g/mol. Its IUPAC name is 2-[2-(3-methylpiperidin-1-yl)-7-oxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[2-(3-methylpiperidin-1-yl)-7-oxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 51363527 |
| Molecular Formula | C22H27N5O2S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-[2-(3-methylpiperidin-1-yl)-7-oxo-[1,3]thiazolo[4,5-d]pyrimidin-6-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | CC1CCCN(c2nc3ncn(CC(=O)NCCCc4ccccc4)c(=O)c3s2)C1 |
| InChI | InChI=1S/C22H27N5O2S/c1-16-7-6-12-26(13-16)22-25-20-19(30-22)21(29)27(15-24-20)14-18(28)23-11-5-10-17-8-3-2-4-9-17/h2-4,8-9,15-16H,5-7,10-14H2,1H3,(H,23,28) |
| InChIKey | VSCTXDPTQWRAAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|