About 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione
2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione (PubChem CID 5136397) has the molecular formula C17H16O5
and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione.
Molecular Properties
| Compound Name | 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione |
| PubChem CID | 5136397 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione |
| SMILES | CC1(C)C=C(O)C(C2(O)C(=O)c3ccccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C17H16O5/c1-16(2)7-11(18)13(12(19)8-16)17(22)14(20)9-5-3-4-6-10(9)15(17)21/h3-7,13,18,22H,8H2,1-2H3 |
| InChIKey | GYSDYAJVCYHQQU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione?
The IUPAC name of 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione (CID 5136397) is 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione.
What is the SMILES notation for 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione?
The canonical SMILES for 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione is CC1(C)C=C(O)C(C2(O)C(=O)c3ccccc3C2=O)C(=O)C1.
What is the InChIKey of 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione?
The InChIKey is GYSDYAJVCYHQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O5/c1-16(2)7-11(18)13(12(19)8-16)17(22)14(20)9-5-3-4-6-10(9)15(17)21/h3-7,13,18,22H,8H2,1-2H3.
What are the key properties of 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione?
2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione has a molecular weight of 300.31 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(2-hydroxy-4,4-dimethyl-6-oxocyclohex-2-en-1-yl)indene-1,3-dione is sourced from PubChem (CID 5136397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).