C19H18ClN3O2 — CID 5136458
4-(2-chloroquinolin-3-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione (PubChem CID 5136458) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-(2-chloroquinolin-3-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione.
| Compound Name | 4-(2-chloroquinolin-3-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
|---|---|
| PubChem CID | 5136458 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-(2-chloroquinolin-3-yl)-7,7-dimethyl-3,4,6,8-tetrahydro-1H-quinazoline-2,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC(=O)NC2c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C19H18ClN3O2/c1-19(2)8-13-15(14(24)9-19)16(23-18(25)22-13)11-7-10-5-3-4-6-12(10)21-17(11)20/h3-7,16H,8-9H2,1-2H3,(H2,22,23,25) |
| InChIKey | FQQYPESMLDVAHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|