C24H22N2O3S — CID 51365302
3-(3,5-dimethoxyphenyl)-2-(2-phenylethylsulfanyl)quinazolin-4-one (PubChem CID 51365302) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-2-(2-phenylethylsulfanyl)quinazolin-4-one.
| Compound Name | 3-(3,5-dimethoxyphenyl)-2-(2-phenylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 51365302 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-2-(2-phenylethylsulfanyl)quinazolin-4-one |
| SMILES | COc1cc(OC)cc(-n2c(SCCc3ccccc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-28-19-14-18(15-20(16-19)29-2)26-23(27)21-10-6-7-11-22(21)25-24(26)30-13-12-17-8-4-3-5-9-17/h3-11,14-16H,12-13H2,1-2H3 |
| InChIKey | JDSMHGKYZYMCHX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |