C22H16ClFN2O2S — CID 51365639
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one (PubChem CID 51365639) has the molecular formula C22H16ClFN2O2S and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 51365639 |
| Molecular Formula | C22H16ClFN2O2S |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1cccc(-n2c(SCc3ccc(F)cc3Cl)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H16ClFN2O2S/c1-28-17-6-4-5-16(12-17)26-21(27)18-7-2-3-8-20(18)25-22(26)29-13-14-9-10-15(24)11-19(14)23/h2-12H,13H2,1H3 |
| InChIKey | GRUYEIWIGSPNNY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |