C26H26N2O2S — CID 5136586
[3-amino-4-(5-methylfuran-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(2,4,5-trimethylphenyl)methanone (PubChem CID 5136586) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is [3-amino-4-(5-methylfuran-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(2,4,5-trimethylphenyl)methanone.
| Compound Name | [3-amino-4-(5-methylfuran-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 5136586 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [3-amino-4-(5-methylfuran-2-yl)-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-(2,4,5-trimethylphenyl)methanone |
| SMILES | Cc1ccc(-c2c3c(nc4sc(C(=O)c5cc(C)c(C)cc5C)c(N)c24)CCCC3)o1 |
| InChI | InChI=1S/C26H26N2O2S/c1-13-11-15(3)18(12-14(13)2)24(29)25-23(27)22-21(20-10-9-16(4)30-20)17-7-5-6-8-19(17)28-26(22)31-25/h9-12H,5-8,27H2,1-4H3 |
| InChIKey | MBWHQQUXZZPLFD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |