C23H29N3O3 — CID 51366084
N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]propanamide (PubChem CID 51366084) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]propanamide |
|---|---|
| PubChem CID | 51366084 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-ethoxyphenyl)-6-oxopyridazin-1-yl]propanamide |
| SMILES | CCOc1ccc(-c2ccc(=O)n(CCC(=O)NCCC3=CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-2-29-20-10-8-19(9-11-20)21-12-13-23(28)26(25-21)17-15-22(27)24-16-14-18-6-4-3-5-7-18/h6,8-13H,2-5,7,14-17H2,1H3,(H,24,27) |
| InChIKey | MRVIKGCXDNLMDV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|