About 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline
3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline (PubChem CID 51366198) has the molecular formula C22H22N6O2S
and a molecular weight of 434.53 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline |
| PubChem CID | 51366198 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline |
| SMILES | C=CCN1CCN(c2nc3c(S(=O)(=O)c4ccccc4)nnn3c3ccccc23)CC1 |
| InChI | InChI=1S/C22H22N6O2S/c1-2-12-26-13-15-27(16-14-26)20-18-10-6-7-11-19(18)28-21(23-20)22(24-25-28)31(29,30)17-8-4-3-5-9-17/h2-11H,1,12-16H2 |
| InChIKey | FGRWSOUATGDGET-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline?
The IUPAC name of 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline (CID 51366198) is 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline.
What is the SMILES notation for 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline?
The canonical SMILES for 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline is C=CCN1CCN(c2nc3c(S(=O)(=O)c4ccccc4)nnn3c3ccccc23)CC1.
What is the InChIKey of 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline?
The InChIKey is FGRWSOUATGDGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N6O2S/c1-2-12-26-13-15-27(16-14-26)20-18-10-6-7-11-19(18)28-21(23-20)22(24-25-28)31(29,30)17-8-4-3-5-9-17/h2-11H,1,12-16H2.
What are the key properties of 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline?
3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline has a molecular weight of 434.53 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-5-(4-prop-2-enylpiperazin-1-yl)triazolo[1,5-a]quinazoline is sourced from PubChem (CID 51366198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).