About 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine
7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 5136721) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| PubChem CID | 5136721 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-8-9(5-7(6)10)12-3-2-11-8/h4-5H,2-3,10H2,1H3 |
| InChIKey | ARAHLXHMPGGAEQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine?
The IUPAC name of 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine (CID 5136721) is 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine.
What is the SMILES notation for 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine?
The canonical SMILES for 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine is Cc1cc2c(cc1N)OCCO2.
What is the InChIKey of 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine?
The InChIKey is ARAHLXHMPGGAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-4-8-9(5-7(6)10)12-3-2-11-8/h4-5H,2-3,10H2,1H3.
What are the key properties of 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine?
7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine has a molecular weight of 165.19 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydro-1,4-benzodioxin-6-amine is sourced from PubChem (CID 5136721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).