C24H31NO8 — CID 5136759
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 5136759) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 5136759 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)c2ccc(OC)c(OC)c2OC)cc1OCC |
| InChI | InChI=1S/C24H31NO8/c1-6-31-18-10-8-16(14-20(18)32-7-2)12-13-25-21(26)15-33-24(27)17-9-11-19(28-3)23(30-5)22(17)29-4/h8-11,14H,6-7,12-13,15H2,1-5H3,(H,25,26) |
| InChIKey | ZGBMSRFZSGNBQL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |