C15H8BrClF4N2OS — CID 513683
3-(6-bromo-2-pyridinyl)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 513683) has the molecular formula C15H8BrClF4N2OS and a molecular weight of 455.66 g/mol. Its IUPAC name is 3-(6-bromo-2-pyridinyl)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-(6-bromo-2-pyridinyl)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 513683 |
| Molecular Formula | C15H8BrClF4N2OS |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 453.92 |
| IUPAC Name | 3-(6-bromo-2-pyridinyl)-2-[3-chloro-2-fluoro-6-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2c(C(F)(F)F)ccc(Cl)c2F)N1c1cccc(Br)n1 |
| InChI | InChI=1S/C15H8BrClF4N2OS/c16-9-2-1-3-10(22-9)23-11(24)6-25-14(23)12-7(15(19,20)21)4-5-8(17)13(12)18/h1-5,14H,6H2 |
| InChIKey | MDKNZWNTVMGCSU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|