C21H14Cl2N4S2 — CID 51368446
6-[5-(2,5-dichlorophenyl)thiophen-2-yl]-3-(3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 51368446) has the molecular formula C21H14Cl2N4S2 and a molecular weight of 457.41 g/mol. Its IUPAC name is 6-[5-(2,5-dichlorophenyl)thiophen-2-yl]-3-(3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-[5-(2,5-dichlorophenyl)thiophen-2-yl]-3-(3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 51368446 |
| Molecular Formula | C21H14Cl2N4S2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 6-[5-(2,5-dichlorophenyl)thiophen-2-yl]-3-(3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1cccc(-c2nnc3n2N=C(c2ccc(-c4cc(Cl)ccc4Cl)s2)CS3)c1 |
| InChI | InChI=1S/C21H14Cl2N4S2/c1-12-3-2-4-13(9-12)20-24-25-21-27(20)26-17(11-28-21)19-8-7-18(29-19)15-10-14(22)5-6-16(15)23/h2-10H,11H2,1H3 |
| InChIKey | YLQRMLLXJZPPPB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |