C13H11Cl2N5S — CID 51368454
4-amino-3-[5-(2,5-dichlorophenyl)-1-methylpyrrol-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 51368454) has the molecular formula C13H11Cl2N5S and a molecular weight of 340.24 g/mol. Its IUPAC name is 4-amino-3-[5-(2,5-dichlorophenyl)-1-methylpyrrol-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[5-(2,5-dichlorophenyl)-1-methylpyrrol-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 51368454 |
| Molecular Formula | C13H11Cl2N5S |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-amino-3-[5-(2,5-dichlorophenyl)-1-methylpyrrol-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(-c2cc(Cl)ccc2Cl)ccc1-c1n[nH]c(=S)n1N |
| InChI | InChI=1S/C13H11Cl2N5S/c1-19-10(8-6-7(14)2-3-9(8)15)4-5-11(19)12-17-18-13(21)20(12)16/h2-6H,16H2,1H3,(H,18,21) |
| InChIKey | IODXQNINGWKWCC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|