C25H33N5O4 — CID 5136894
N-butyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide (PubChem CID 5136894) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-butyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-butyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 5136894 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | N-butyl-3-[2-(furan-2-ylmethylamino)-2-oxoethyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxamide |
| SMILES | CCCCNC(=O)N1CCC2(CC1)C(=O)N(CC(=O)NCc1ccco1)CN2c1ccccc1 |
| InChI | InChI=1S/C25H33N5O4/c1-2-3-13-26-24(33)28-14-11-25(12-15-28)23(32)29(19-30(25)20-8-5-4-6-9-20)18-22(31)27-17-21-10-7-16-34-21/h4-10,16H,2-3,11-15,17-19H2,1H3,(H,26,33)(H,27,31) |
| InChIKey | IPHIQCHVAOTYIN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|