C18H22FN3O4 — CID 51369059
2-[2-(3-fluorophenyl)-5-(2-hydroxyethyl)-4-methyl-6-oxopyrimidin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 51369059) has the molecular formula C18H22FN3O4 and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-5-(2-hydroxyethyl)-4-methyl-6-oxopyrimidin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[2-(3-fluorophenyl)-5-(2-hydroxyethyl)-4-methyl-6-oxopyrimidin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 51369059 |
| Molecular Formula | C18H22FN3O4 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-5-(2-hydroxyethyl)-4-methyl-6-oxopyrimidin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c(-c2cccc(F)c2)nc(C)c(CCO)c1=O |
| InChI | InChI=1S/C18H22FN3O4/c1-12-15(6-8-23)18(25)22(11-16(24)20-7-9-26-2)17(21-12)13-4-3-5-14(19)10-13/h3-5,10,23H,6-9,11H2,1-2H3,(H,20,24) |
| InChIKey | UFUFVESQXMPRFD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|