C20H18ClNO3 — CID 51370810
(E)-3-(5-chloro-7-methoxy-1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 51370810) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is (E)-3-(5-chloro-7-methoxy-1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-7-methoxy-1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51370810 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (E)-3-(5-chloro-7-methoxy-1-benzofuran-2-yl)-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(Cl)cc2cc(/C=C/C(=O)Nc3ccc(C)c(C)c3)oc12 |
| InChI | InChI=1S/C20H18ClNO3/c1-12-4-5-16(8-13(12)2)22-19(23)7-6-17-10-14-9-15(21)11-18(24-3)20(14)25-17/h4-11H,1-3H3,(H,22,23)/b7-6+ |
| InChIKey | XVVOVFWXPIJLSY-VOTSOKGWSA-N |
| XLogP | 5.36 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|